zulip/zerver/views/streams.py

469 lines
21 KiB
Python

from __future__ import absolute_import
from typing import Any, Optional, Tuple, List, Set, Iterable, Mapping, Callable, Dict, Text
from django.utils.translation import ugettext as _
from django.conf import settings
from django.db import transaction
from django.http import HttpRequest, HttpResponse
from zerver.lib.request import JsonableError, REQ, has_request_variables
from zerver.decorator import authenticated_json_post_view, \
authenticated_json_view, require_realm_admin, to_non_negative_int
from zerver.lib.actions import bulk_remove_subscriptions, \
do_change_subscription_property, internal_prep_private_message, \
internal_prep_stream_message, \
gather_subscriptions, subscribed_to_stream, \
bulk_add_subscriptions, do_send_messages, get_subscriber_emails, do_rename_stream, \
do_deactivate_stream, do_change_stream_invite_only, do_add_default_stream, \
do_change_stream_description, do_get_streams, \
do_remove_default_stream, get_topic_history_for_stream, \
prep_stream_welcome_message
from zerver.lib.response import json_success, json_error, json_response
from zerver.lib.streams import access_stream_by_id, access_stream_by_name, \
check_stream_name, check_stream_name_available, filter_stream_authorization, \
list_to_streams
from zerver.lib.validator import check_string, check_int, check_list, check_dict, \
check_bool, check_variable_type
from zerver.models import UserProfile, Stream, Realm, Subscription, \
Recipient, get_recipient, get_stream, get_active_user_dicts_in_realm, \
get_system_bot, get_user
from collections import defaultdict
import ujson
from six.moves import urllib
import six
class PrincipalError(JsonableError):
def __init__(self, principal, status_code=403):
# type: (Text, int) -> None
self.principal = principal # type: Text
self.status_code = status_code # type: int
def to_json_error_msg(self):
# type: () -> Text
return ("User not authorized to execute queries on behalf of '%s'"
% (self.principal,))
def principal_to_user_profile(agent, principal):
# type: (UserProfile, Text) -> UserProfile
try:
return get_user(principal, agent.realm)
except UserProfile.DoesNotExist:
# We have to make sure we don't leak information about which users
# are registered for Zulip in a different realm. We could do
# something a little more clever and check the domain part of the
# principal to maybe give a better error message
raise PrincipalError(principal)
@require_realm_admin
def deactivate_stream_backend(request, user_profile, stream_id):
# type: (HttpRequest, UserProfile, int) -> HttpResponse
(stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
do_deactivate_stream(stream)
return json_success()
@require_realm_admin
@has_request_variables
def add_default_stream(request, user_profile, stream_name=REQ()):
# type: (HttpRequest, UserProfile, Text) -> HttpResponse
(stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
do_add_default_stream(stream)
return json_success()
@require_realm_admin
@has_request_variables
def remove_default_stream(request, user_profile, stream_name=REQ()):
# type: (HttpRequest, UserProfile, Text) -> HttpResponse
(stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
do_remove_default_stream(stream)
return json_success()
@require_realm_admin
@has_request_variables
def update_stream_backend(request, user_profile, stream_id,
description=REQ(validator=check_string, default=None),
is_private=REQ(validator=check_bool, default=None),
new_name=REQ(validator=check_string, default=None)):
# type: (HttpRequest, UserProfile, int, Optional[Text], Optional[bool], Optional[Text]) -> HttpResponse
(stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
if description is not None:
do_change_stream_description(stream, description)
if new_name is not None:
new_name = new_name.strip()
if stream.name == new_name:
return json_error(_("Stream already has that name!"))
if stream.name.lower() != new_name.lower():
# Check that the stream name is available (unless we are
# are only changing the casing of the stream name).
check_stream_name_available(user_profile.realm, new_name)
do_rename_stream(stream, new_name)
if is_private is not None:
do_change_stream_invite_only(stream, is_private)
return json_success()
def list_subscriptions_backend(request, user_profile):
# type: (HttpRequest, UserProfile) -> HttpResponse
return json_success({"subscriptions": gather_subscriptions(user_profile)[0]})
FuncKwargPair = Tuple[Callable[..., HttpResponse], Dict[str, Iterable[Any]]]
@has_request_variables
def update_subscriptions_backend(request, user_profile,
delete=REQ(validator=check_list(check_string), default=[]),
add=REQ(validator=check_list(check_dict([('name', check_string)])), default=[])):
# type: (HttpRequest, UserProfile, Iterable[Text], Iterable[Mapping[str, Any]]) -> HttpResponse
if not add and not delete:
return json_error(_('Nothing to do. Specify at least one of "add" or "delete".'))
method_kwarg_pairs = [
(add_subscriptions_backend, dict(streams_raw=add)),
(remove_subscriptions_backend, dict(streams_raw=delete))
] # type: List[FuncKwargPair]
return compose_views(request, user_profile, method_kwarg_pairs)
def compose_views(request, user_profile, method_kwarg_pairs):
# type: (HttpRequest, UserProfile, List[FuncKwargPair]) -> HttpResponse
'''
This takes a series of view methods from method_kwarg_pairs and calls
them in sequence, and it smushes all the json results into a single
response when everything goes right. (This helps clients avoid extra
latency hops.) It rolls back the transaction when things go wrong in
any one of the composed methods.
TODO: Move this a utils-like module if we end up using it more widely.
'''
json_dict = {} # type: Dict[str, Any]
with transaction.atomic():
for method, kwargs in method_kwarg_pairs:
response = method(request, user_profile, **kwargs)
if response.status_code != 200:
raise JsonableError(response.content)
json_dict.update(ujson.loads(response.content))
return json_success(json_dict)
@has_request_variables
def remove_subscriptions_backend(request, user_profile,
streams_raw = REQ("subscriptions", validator=check_list(check_string)),
principals = REQ(validator=check_list(check_string), default=None)):
# type: (HttpRequest, UserProfile, Iterable[Text], Optional[Iterable[Text]]) -> HttpResponse
removing_someone_else = principals and \
set(principals) != set((user_profile.email,))
if removing_someone_else and not user_profile.is_realm_admin:
# You can only unsubscribe other people from a stream if you are a realm
# admin.
return json_error(_("This action requires administrative rights"))
streams_as_dict = []
for stream_name in streams_raw:
streams_as_dict.append({"name": stream_name.strip()})
streams, __ = list_to_streams(streams_as_dict, user_profile)
for stream in streams:
if removing_someone_else and stream.invite_only and \
not subscribed_to_stream(user_profile, stream):
# Even as an admin, you can't remove other people from an
# invite-only stream you're not on.
return json_error(_("Cannot administer invite-only streams this way"))
if principals:
people_to_unsub = set(principal_to_user_profile(
user_profile, principal) for principal in principals)
else:
people_to_unsub = set([user_profile])
result = dict(removed=[], not_subscribed=[]) # type: Dict[str, List[Text]]
(removed, not_subscribed) = bulk_remove_subscriptions(people_to_unsub, streams)
for (subscriber, stream) in removed:
result["removed"].append(stream.name)
for (subscriber, stream) in not_subscribed:
result["not_subscribed"].append(stream.name)
return json_success(result)
def you_were_just_subscribed_message(acting_user, stream_names, private_stream_names):
# type: (UserProfile, Set[Text], Set[Text]) -> Text
# stream_names is the list of streams for which we should send notifications.
#
# We only use private_stream_names to see which of those names
# are private; it can possibly be a superset of stream_names due to the way the
# calling code is structured.
subscriptions = sorted(list(stream_names))
msg = "Hi there! We thought you'd like to know that %s just subscribed you to " % (
acting_user.full_name,)
if len(subscriptions) == 1:
invite_only = subscriptions[0] in private_stream_names
msg += "the%s stream #**%s**." % (" **invite-only**" if invite_only else "",
subscriptions[0])
else:
msg += "the following streams: \n\n"
for stream_name in subscriptions:
invite_only = stream_name in private_stream_names
msg += "* #**%s**%s\n" % (stream_name,
" (**invite-only**)" if invite_only else "")
public_stream_names = stream_names - private_stream_names
if public_stream_names:
msg += "\nYou can see historical content on a non-invite-only stream by narrowing to it."
return msg
@has_request_variables
def add_subscriptions_backend(request, user_profile,
streams_raw = REQ("subscriptions",
validator=check_list(check_dict([('name', check_string)]))),
invite_only = REQ(validator=check_bool, default=False),
announce = REQ(validator=check_bool, default=False),
principals = REQ(validator=check_list(check_string), default=[]),
authorization_errors_fatal = REQ(validator=check_bool, default=True)):
# type: (HttpRequest, UserProfile, Iterable[Mapping[str, Text]], bool, bool, List[Text], bool) -> HttpResponse
stream_dicts = []
for stream_dict in streams_raw:
stream_dict_copy = {} # type: Dict[str, Any]
for field in stream_dict:
stream_dict_copy[field] = stream_dict[field]
# Strip the stream name here.
stream_dict_copy['name'] = stream_dict_copy['name'].strip()
stream_dict_copy["invite_only"] = invite_only
stream_dicts.append(stream_dict_copy)
# Validation of the streams arguments, including enforcement of
# can_create_streams policy and check_stream_name policy is inside
# list_to_streams.
existing_streams, created_streams = \
list_to_streams(stream_dicts, user_profile, autocreate=True)
authorized_streams, unauthorized_streams = \
filter_stream_authorization(user_profile, existing_streams)
if len(unauthorized_streams) > 0 and authorization_errors_fatal:
return json_error(_("Unable to access stream (%s).") % unauthorized_streams[0].name)
# Newly created streams are also authorized for the creator
streams = authorized_streams + created_streams
if len(principals) > 0:
if user_profile.realm.is_zephyr_mirror_realm and not all(stream.invite_only for stream in streams):
return json_error(_("You can only invite other Zephyr mirroring users to invite-only streams."))
subscribers = set(principal_to_user_profile(user_profile, principal) for principal in principals)
else:
subscribers = set([user_profile])
(subscribed, already_subscribed) = bulk_add_subscriptions(streams, subscribers)
result = dict(subscribed=defaultdict(list), already_subscribed=defaultdict(list)) # type: Dict[str, Any]
for (subscriber, stream) in subscribed:
result["subscribed"][subscriber.email].append(stream.name)
for (subscriber, stream) in already_subscribed:
result["already_subscribed"][subscriber.email].append(stream.name)
bots = dict((subscriber.email, subscriber.is_bot) for subscriber in subscribers)
newly_created_stream_names = {stream.name for stream in created_streams}
private_stream_names = {stream.name for stream in streams if stream.invite_only}
# Inform the user if someone else subscribed them to stuff,
# or if a new stream was created with the "announce" option.
notifications = []
if len(principals) > 0 and result["subscribed"]:
for email, subscribed_stream_names in six.iteritems(result["subscribed"]):
if email == user_profile.email:
# Don't send a Zulip if you invited yourself.
continue
if bots[email]:
# Don't send invitation Zulips to bots
continue
# For each user, we notify them about newly subscribed streams, except for
# streams that were newly created.
notify_stream_names = set(subscribed_stream_names) - newly_created_stream_names
if not notify_stream_names:
continue
msg = you_were_just_subscribed_message(
acting_user=user_profile,
stream_names=notify_stream_names,
private_stream_names=private_stream_names
)
sender = get_system_bot(settings.NOTIFICATION_BOT)
notifications.append(
internal_prep_private_message(
realm=user_profile.realm,
sender=sender,
recipient_email=email,
content=msg))
if announce and len(created_streams) > 0:
notifications_stream = user_profile.realm.notifications_stream # type: Optional[Stream]
if notifications_stream is not None:
if len(created_streams) > 1:
stream_msg = "the following streams: %s" % (", ".join('#**%s**' % s.name for s in created_streams))
else:
stream_msg = "a new stream #**%s**." % created_streams[0].name
msg = ("%s just created %s" % (user_profile.full_name, stream_msg))
sender = get_system_bot(settings.NOTIFICATION_BOT)
stream_name = notifications_stream.name
topic = 'Streams'
notifications.append(
internal_prep_stream_message(
realm=user_profile.realm,
sender=sender,
stream_name=stream_name,
topic=topic,
content=msg))
if not user_profile.realm.is_zephyr_mirror_realm:
for stream in created_streams:
notifications.append(prep_stream_welcome_message(stream))
if len(notifications) > 0:
do_send_messages(notifications)
result["subscribed"] = dict(result["subscribed"])
result["already_subscribed"] = dict(result["already_subscribed"])
if not authorization_errors_fatal:
result["unauthorized"] = [stream.name for stream in unauthorized_streams]
return json_success(result)
@has_request_variables
def get_subscribers_backend(request, user_profile,
stream_id=REQ('stream', converter=to_non_negative_int)):
# type: (HttpRequest, UserProfile, int) -> HttpResponse
(stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
subscribers = get_subscriber_emails(stream, user_profile)
return json_success({'subscribers': subscribers})
# By default, lists all streams that the user has access to --
# i.e. public streams plus invite-only streams that the user is on
@has_request_variables
def get_streams_backend(request, user_profile,
include_public=REQ(validator=check_bool, default=True),
include_subscribed=REQ(validator=check_bool, default=True),
include_all_active=REQ(validator=check_bool, default=False),
include_default=REQ(validator=check_bool, default=False)):
# type: (HttpRequest, UserProfile, bool, bool, bool, bool) -> HttpResponse
streams = do_get_streams(user_profile, include_public=include_public,
include_subscribed=include_subscribed,
include_all_active=include_all_active,
include_default=include_default)
return json_success({"streams": streams})
@has_request_variables
def get_topics_backend(request, user_profile,
stream_id=REQ(converter=to_non_negative_int)):
# type: (HttpRequest, UserProfile, int) -> HttpResponse
(stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
result = get_topic_history_for_stream(
user_profile=user_profile,
recipient=recipient,
)
# Our data structure here is a list of tuples of
# (topic name, unread count), and it's reverse chronological,
# so the most recent topic is the first element of the list.
return json_success(dict(topics=result))
@authenticated_json_post_view
@has_request_variables
def json_stream_exists(request, user_profile, stream_name=REQ("stream"),
autosubscribe=REQ(validator=check_bool, default=False)):
# type: (HttpRequest, UserProfile, Text, bool) -> HttpResponse
check_stream_name(stream_name)
try:
(stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
except JsonableError as e:
result = {"exists": False}
return json_error(e.error, data=result, status=404)
# access_stream functions return a subscription if and only if we
# are already subscribed.
result = {"exists": True,
"subscribed": sub is not None}
# If we got here, we're either subscribed or the stream is public.
# So if we're not yet subscribed and autosubscribe is enabled, we
# should join.
if sub is None and autosubscribe:
bulk_add_subscriptions([stream], [user_profile])
result["subscribed"] = True
return json_success(result) # results are ignored for HEAD requests
@has_request_variables
def json_get_stream_id(request, user_profile, stream_name=REQ('stream')):
# type: (HttpRequest, UserProfile, Text) -> HttpResponse
(stream, recipient, sub) = access_stream_by_name(user_profile, stream_name)
return json_success({'stream_id': stream.id})
@has_request_variables
def update_subscriptions_property(request, user_profile, stream_id=REQ(), property=REQ(), value=REQ()):
# type: (HttpRequest, UserProfile, int, str, str) -> HttpResponse
subscription_data = [{"property": property,
"stream_id": stream_id,
"value": value}]
return update_subscription_properties_backend(request, user_profile,
subscription_data=subscription_data)
@has_request_variables
def update_subscription_properties_backend(request, user_profile, subscription_data=REQ(
validator=check_list(
check_dict([("stream_id", check_int),
("property", check_string),
("value", check_variable_type(
[check_string, check_bool]))])))):
# type: (HttpRequest, UserProfile, List[Dict[str, Any]]) -> HttpResponse
"""
This is the entry point to changing subscription properties. This
is a bulk endpoint: requestors always provide a subscription_data
list containing dictionaries for each stream of interest.
Requests are of the form:
[{"stream_id": "1", "property": "in_home_view", "value": False},
{"stream_id": "1", "property": "color", "value": "#c2c2c2"}]
"""
property_converters = {"color": check_string, "in_home_view": check_bool,
"desktop_notifications": check_bool,
"audible_notifications": check_bool,
"pin_to_top": check_bool}
response_data = []
for change in subscription_data:
stream_id = change["stream_id"]
property = change["property"]
value = change["value"]
if property not in property_converters:
return json_error(_("Unknown subscription property: %s") % (property,))
(stream, recipient, sub) = access_stream_by_id(user_profile, stream_id)
if sub is None:
return json_error(_("Not subscribed to stream id %d") % (stream_id,))
property_conversion = property_converters[property](property, value)
if property_conversion:
return json_error(property_conversion)
do_change_subscription_property(user_profile, sub, stream,
property, value)
response_data.append({'stream_id': stream_id,
'property': property,
'value': value})
return json_success({"subscription_data": response_data})