from __future__ import absolute_import from typing import Any, Optional, Tuple, List, Set, Iterable, Mapping, Callable, Dict from django.utils.translation import ugettext as _ from django.conf import settings from django.db import transaction from django.http import HttpRequest, HttpResponse from zerver.lib.request import JsonableError, REQ, has_request_variables from zerver.decorator import authenticated_json_post_view, \ authenticated_json_view, \ get_user_profile_by_email, require_realm_admin, to_non_negative_int from zerver.lib.actions import bulk_remove_subscriptions, \ do_change_subscription_property, internal_prep_message, \ create_streams_if_needed, gather_subscriptions, subscribed_to_stream, \ bulk_add_subscriptions, do_send_messages, get_subscriber_emails, do_rename_stream, \ do_deactivate_stream, do_make_stream_public, do_add_default_stream, \ do_change_stream_description, do_get_streams, do_make_stream_private, \ do_remove_default_stream, get_topic_history_for_stream from zerver.lib.response import json_success, json_error, json_response from zerver.lib.validator import check_string, check_list, check_dict, \ check_bool, check_variable_type from zerver.models import UserProfile, Stream, Subscription, \ Recipient, get_recipient, get_stream, bulk_get_streams, \ bulk_get_recipients, valid_stream_name, get_active_user_dicts_in_realm from collections import defaultdict import ujson from six.moves import urllib import six from six import text_type def is_active_subscriber(user_profile, recipient): # type: (UserProfile, Recipient) -> bool return Subscription.objects.filter(user_profile=user_profile, recipient=recipient, active=True).exists() def list_to_streams(streams_raw, user_profile, autocreate=False): # type: (Iterable[Mapping[str, Any]], UserProfile, Optional[bool]) -> Tuple[List[Stream], List[Stream]] """Converts list of dicts to a list of Streams, validating input in the process For each stream name, we validate it to ensure it meets our requirements for a proper stream name: that is, that it is shorter than Stream.MAX_NAME_LENGTH characters and passes valid_stream_name. This function in autocreate mode should be atomic: either an exception will be raised during a precheck, or all the streams specified will have been created if applicable. @param streams_raw The list of stream dictionaries to process; names should already be stripped of whitespace by the caller. @param user_profile The user for whom we are retreiving the streams @param autocreate Whether we should create streams if they don't already exist """ # Validate all streams, getting extant ones, then get-or-creating the rest. stream_set = set(stream_dict["name"] for stream_dict in streams_raw) for stream_name in stream_set: # Stream names should already have been stripped by the # caller, but it makes sense to verify anyway. assert stream_name == stream_name.strip() if len(stream_name) > Stream.MAX_NAME_LENGTH: raise JsonableError(_("Stream name (%s) too long.") % (stream_name,)) if not valid_stream_name(stream_name): raise JsonableError(_("Invalid stream name (%s).") % (stream_name,)) existing_streams = [] # type: List[Stream] missing_stream_dicts = [] # type: List[Mapping[str, Any]] existing_stream_map = bulk_get_streams(user_profile.realm, stream_set) for stream_dict in streams_raw: stream_name = stream_dict["name"] stream = existing_stream_map.get(stream_name.lower()) if stream is None: missing_stream_dicts.append(stream_dict) else: existing_streams.append(stream) if len(missing_stream_dicts) == 0: # This is the happy path for callers who expected all of these # streams to exist already. created_streams = [] # type: List[Stream] else: # autocreate=True path starts here if not user_profile.can_create_streams(): raise JsonableError(_('User cannot create streams.')) elif not autocreate: raise JsonableError(_("Stream(s) (%s) do not exist") % ", ".join( stream_dict["name"] for stream_dict in missing_stream_dicts)) # We already filtered out existing streams, so dup_streams # will normally be an empty list below, but we protect against somebody # else racing to create the same stream. (This is not an entirely # paranoid approach, since often on Zulip two people will discuss # creating a new stream, and both people eagerly do it.) created_streams, dup_streams = create_streams_if_needed(realm=user_profile.realm, stream_dicts=missing_stream_dicts) existing_streams += dup_streams return existing_streams, created_streams class PrincipalError(JsonableError): def __init__(self, principal, status_code=403): # type: (text_type, int) -> None self.principal = principal # type: text_type self.status_code = status_code # type: int def to_json_error_msg(self): # type: () -> text_type return ("User not authorized to execute queries on behalf of '%s'" % (self.principal,)) def principal_to_user_profile(agent, principal): # type: (UserProfile, text_type) -> UserProfile principal_doesnt_exist = False try: principal_user_profile = get_user_profile_by_email(principal) except UserProfile.DoesNotExist: principal_doesnt_exist = True if (principal_doesnt_exist or agent.realm != principal_user_profile.realm): # We have to make sure we don't leak information about which users # are registered for Zulip in a different realm. We could do # something a little more clever and check the domain part of the # principal to maybe give a better error message raise PrincipalError(principal) return principal_user_profile @require_realm_admin def deactivate_stream_backend(request, user_profile, stream_name): # type: (HttpRequest, UserProfile, text_type) -> HttpResponse target = get_stream(stream_name, user_profile.realm) if not target: return json_error(_('No such stream name')) if target.invite_only and not subscribed_to_stream(user_profile, target): return json_error(_('Cannot administer invite-only streams this way')) do_deactivate_stream(target) return json_success() @require_realm_admin @has_request_variables def add_default_stream(request, user_profile, stream_name=REQ()): # type: (HttpRequest, UserProfile, text_type) -> HttpResponse do_add_default_stream(user_profile.realm, stream_name) return json_success() @require_realm_admin @has_request_variables def remove_default_stream(request, user_profile, stream_name=REQ()): # type: (HttpRequest, UserProfile, text_type) -> HttpResponse do_remove_default_stream(user_profile.realm, stream_name) return json_success() @authenticated_json_post_view @require_realm_admin @has_request_variables def json_make_stream_public(request, user_profile, stream_name=REQ()): # type: (HttpRequest, UserProfile, text_type) -> HttpResponse do_make_stream_public(user_profile, user_profile.realm, stream_name) return json_success() @authenticated_json_post_view @require_realm_admin @has_request_variables def json_make_stream_private(request, user_profile, stream_name=REQ()): # type: (HttpRequest, UserProfile, text_type) -> HttpResponse do_make_stream_private(user_profile.realm, stream_name) return json_success() @require_realm_admin @has_request_variables def update_stream_backend(request, user_profile, stream_name, description=REQ(validator=check_string, default=None), new_name=REQ(validator=check_string, default=None)): # type: (HttpRequest, UserProfile, text_type, Optional[text_type], Optional[text_type]) -> HttpResponse if description is not None: do_change_stream_description(user_profile.realm, stream_name, description) if stream_name is not None and new_name is not None: do_rename_stream(user_profile.realm, stream_name, new_name) return json_success() def list_subscriptions_backend(request, user_profile): # type: (HttpRequest, UserProfile) -> HttpResponse return json_success({"subscriptions": gather_subscriptions(user_profile)[0]}) FuncKwargPair = Tuple[Callable[..., HttpResponse], Dict[str, Iterable[Any]]] @has_request_variables def update_subscriptions_backend(request, user_profile, delete=REQ(validator=check_list(check_string), default=[]), add=REQ(validator=check_list(check_dict([('name', check_string)])), default=[])): # type: (HttpRequest, UserProfile, Iterable[text_type], Iterable[Mapping[str, Any]]) -> HttpResponse if not add and not delete: return json_error(_('Nothing to do. Specify at least one of "add" or "delete".')) method_kwarg_pairs = [ (add_subscriptions_backend, dict(streams_raw=add)), (remove_subscriptions_backend, dict(streams_raw=delete)) ] # type: List[FuncKwargPair] return compose_views(request, user_profile, method_kwarg_pairs) def compose_views(request, user_profile, method_kwarg_pairs): # type: (HttpRequest, UserProfile, List[FuncKwargPair]) -> HttpResponse ''' This takes a series of view methods from method_kwarg_pairs and calls them in sequence, and it smushes all the json results into a single response when everything goes right. (This helps clients avoid extra latency hops.) It rolls back the transaction when things go wrong in any one of the composed methods. TODO: Move this a utils-like module if we end up using it more widely. ''' json_dict = {} # type: Dict[str, Any] with transaction.atomic(): for method, kwargs in method_kwarg_pairs: response = method(request, user_profile, **kwargs) if response.status_code != 200: raise JsonableError(response.content) json_dict.update(ujson.loads(response.content)) return json_success(json_dict) @authenticated_json_post_view def json_remove_subscriptions(request, user_profile): # type: (HttpRequest, UserProfile) -> HttpResponse return remove_subscriptions_backend(request, user_profile) @has_request_variables def remove_subscriptions_backend(request, user_profile, streams_raw = REQ("subscriptions", validator=check_list(check_string)), principals = REQ(validator=check_list(check_string), default=None)): # type: (HttpRequest, UserProfile, Iterable[text_type], Optional[Iterable[text_type]]) -> HttpResponse removing_someone_else = principals and \ set(principals) != set((user_profile.email,)) if removing_someone_else and not user_profile.is_realm_admin: # You can only unsubscribe other people from a stream if you are a realm # admin. return json_error(_("This action requires administrative rights")) streams_as_dict = [] for stream_name in streams_raw: streams_as_dict.append({"name": stream_name.strip()}) streams, __ = list_to_streams(streams_as_dict, user_profile) for stream in streams: if removing_someone_else and stream.invite_only and \ not subscribed_to_stream(user_profile, stream): # Even as an admin, you can't remove other people from an # invite-only stream you're not on. return json_error(_("Cannot administer invite-only streams this way")) if principals: people_to_unsub = set(principal_to_user_profile( user_profile, principal) for principal in principals) else: people_to_unsub = set([user_profile]) result = dict(removed=[], not_subscribed=[]) # type: Dict[str, List[text_type]] (removed, not_subscribed) = bulk_remove_subscriptions(people_to_unsub, streams) for (subscriber, stream) in removed: result["removed"].append(stream.name) for (subscriber, stream) in not_subscribed: result["not_subscribed"].append(stream.name) return json_success(result) def filter_stream_authorization(user_profile, streams): # type: (UserProfile, Iterable[Stream]) -> Tuple[List[Stream], List[Stream]] streams_subscribed = set() # type: Set[int] recipients_map = bulk_get_recipients(Recipient.STREAM, [stream.id for stream in streams]) subs = Subscription.objects.filter(user_profile=user_profile, recipient__in=list(recipients_map.values()), active=True) for sub in subs: streams_subscribed.add(sub.recipient.type_id) unauthorized_streams = [] # type: List[Stream] for stream in streams: # The user is authorized for his own streams if stream.id in streams_subscribed: continue # The user is not authorized for invite_only streams if stream.invite_only: unauthorized_streams.append(stream) authorized_streams = [stream for stream in streams if stream.id not in set(stream.id for stream in unauthorized_streams)] return authorized_streams, unauthorized_streams @has_request_variables def add_subscriptions_backend(request, user_profile, streams_raw = REQ("subscriptions", validator=check_list(check_dict([('name', check_string)]))), invite_only = REQ(validator=check_bool, default=False), announce = REQ(validator=check_bool, default=False), principals = REQ(validator=check_list(check_string), default=None), authorization_errors_fatal = REQ(validator=check_bool, default=True)): # type: (HttpRequest, UserProfile, Iterable[Mapping[str, text_type]], bool, bool, Optional[List[text_type]], bool) -> HttpResponse stream_dicts = [] for stream_dict in streams_raw: stream_dict_copy = {} # type: Dict[str, Any] for field in stream_dict: stream_dict_copy[field] = stream_dict[field] # Strip the stream name here. stream_dict_copy['name'] = stream_dict_copy['name'].strip() stream_dict_copy["invite_only"] = invite_only stream_dicts.append(stream_dict_copy) # Validation of the streams arguments, including enforcement of # can_create_streams policy and valid_stream_name policy is inside # list_to_streams. existing_streams, created_streams = \ list_to_streams(stream_dicts, user_profile, autocreate=True) authorized_streams, unauthorized_streams = \ filter_stream_authorization(user_profile, existing_streams) if len(unauthorized_streams) > 0 and authorization_errors_fatal: return json_error(_("Unable to access stream (%s).") % unauthorized_streams[0].name) # Newly created streams are also authorized for the creator streams = authorized_streams + created_streams if principals is not None: if user_profile.realm.is_zephyr_mirror_realm and not all(stream.invite_only for stream in streams): return json_error(_("You can only invite other Zephyr mirroring users to invite-only streams.")) subscribers = set(principal_to_user_profile(user_profile, principal) for principal in principals) else: subscribers = set([user_profile]) (subscribed, already_subscribed) = bulk_add_subscriptions(streams, subscribers) result = dict(subscribed=defaultdict(list), already_subscribed=defaultdict(list)) # type: Dict[str, Any] for (subscriber, stream) in subscribed: result["subscribed"][subscriber.email].append(stream.name) for (subscriber, stream) in already_subscribed: result["already_subscribed"][subscriber.email].append(stream.name) private_streams = dict((stream.name, stream.invite_only) for stream in streams) bots = dict((subscriber.email, subscriber.is_bot) for subscriber in subscribers) # Inform the user if someone else subscribed them to stuff, # or if a new stream was created with the "announce" option. notifications = [] if principals and result["subscribed"]: for email, subscriptions in six.iteritems(result["subscribed"]): if email == user_profile.email: # Don't send a Zulip if you invited yourself. continue if bots[email]: # Don't send invitation Zulips to bots continue if len(subscriptions) == 1: msg = ("Hi there! We thought you'd like to know that %s just " "subscribed you to the%s stream #**%s**." % (user_profile.full_name, " **invite-only**" if private_streams[subscriptions[0]] else "", subscriptions[0], )) else: msg = ("Hi there! We thought you'd like to know that %s just " "subscribed you to the following streams: \n\n" % (user_profile.full_name,)) for stream in subscriptions: msg += "* #**%s**%s\n" % ( stream, " (**invite-only**)" if private_streams[stream] else "") if len([s for s in subscriptions if not private_streams[s]]) > 0: msg += "\nYou can see historical content on a non-invite-only stream by narrowing to it." notifications.append(internal_prep_message(settings.NOTIFICATION_BOT, "private", email, "", msg)) if announce and len(created_streams) > 0: notifications_stream = user_profile.realm.notifications_stream if notifications_stream is not None: if len(created_streams) > 1: stream_msg = "the following streams: %s" % (", ".join('#**%s**' % s.name for s in created_streams)) else: stream_msg = "a new stream #**%s**." % created_streams[0].name msg = ("%s just created %s" % (user_profile.full_name, stream_msg)) notifications.append( internal_prep_message(settings.NOTIFICATION_BOT, "stream", notifications_stream.name, "Streams", msg, realm=notifications_stream.realm)) else: msg = ("Hi there! %s just created a new stream #**%s**." % (user_profile.full_name, created_streams[0].name)) for realm_user_dict in get_active_user_dicts_in_realm(user_profile.realm): # Don't announce to yourself or to people you explicitly added # (who will get the notification above instead). if realm_user_dict['email'] in principals or realm_user_dict['email'] == user_profile.email: continue notifications.append(internal_prep_message(settings.NOTIFICATION_BOT, "private", realm_user_dict['email'], "", msg)) if len(notifications) > 0: do_send_messages(notifications) result["subscribed"] = dict(result["subscribed"]) result["already_subscribed"] = dict(result["already_subscribed"]) if not authorization_errors_fatal: result["unauthorized"] = [stream.name for stream in unauthorized_streams] return json_success(result) @has_request_variables def get_subscribers_backend(request, user_profile, stream_name=REQ('stream')): # type: (HttpRequest, UserProfile, text_type) -> HttpResponse stream = get_stream(stream_name, user_profile.realm) if stream is None: raise JsonableError(_("Stream does not exist: %s") % (stream_name,)) subscribers = get_subscriber_emails(stream, user_profile) return json_success({'subscribers': subscribers}) # By default, lists all streams that the user has access to -- # i.e. public streams plus invite-only streams that the user is on @has_request_variables def get_streams_backend(request, user_profile, include_public=REQ(validator=check_bool, default=True), include_subscribed=REQ(validator=check_bool, default=True), include_all_active=REQ(validator=check_bool, default=False), include_default=REQ(validator=check_bool, default=False)): # type: (HttpRequest, UserProfile, bool, bool, bool, bool) -> HttpResponse streams = do_get_streams(user_profile, include_public=include_public, include_subscribed=include_subscribed, include_all_active=include_all_active, include_default=include_default) return json_success({"streams": streams}) @has_request_variables def get_topics_backend(request, user_profile, stream_id=REQ(converter=to_non_negative_int)): # type: (HttpRequest, UserProfile, int) -> HttpResponse try: stream = Stream.objects.get(pk=stream_id) except Stream.DoesNotExist: return json_error(_("Invalid stream id")) if stream.realm_id != user_profile.realm_id: return json_error(_("Invalid stream id")) recipient = get_recipient(Recipient.STREAM, stream.id) if not stream.is_public(): if not is_active_subscriber(user_profile=user_profile, recipient=recipient): return json_error(_("Invalid stream id")) result = get_topic_history_for_stream( user_profile=user_profile, recipient=recipient, ) # Our data structure here is a list of tuples of # (topic name, unread count), and it's reverse chronological, # so the most recent topic is the first element of the list. return json_success(dict(topics=result)) @authenticated_json_post_view @has_request_variables def json_stream_exists(request, user_profile, stream=REQ(), autosubscribe=REQ(default=False)): # type: (HttpRequest, UserProfile, text_type, bool) -> HttpResponse return stream_exists_backend(request, user_profile, stream, autosubscribe) def stream_exists_backend(request, user_profile, stream_name, autosubscribe): # type: (HttpRequest, UserProfile, text_type, bool) -> HttpResponse if not valid_stream_name(stream_name): return json_error(_("Invalid characters in stream name")) stream = get_stream(stream_name, user_profile.realm) result = {"exists": bool(stream)} if stream is not None: recipient = get_recipient(Recipient.STREAM, stream.id) if autosubscribe: bulk_add_subscriptions([stream], [user_profile]) result["subscribed"] = is_active_subscriber( user_profile=user_profile, recipient=recipient) return json_success(result) # results are ignored for HEAD requests return json_response(data=result, status=404) def get_subscription_or_die(stream_name, user_profile): # type: (text_type, UserProfile) -> Subscription stream = get_stream(stream_name, user_profile.realm) if not stream: raise JsonableError(_("Invalid stream %s") % (stream_name,)) recipient = get_recipient(Recipient.STREAM, stream.id) subscription = Subscription.objects.filter(user_profile=user_profile, recipient=recipient, active=True) if not subscription.exists(): raise JsonableError(_("Not subscribed to stream %s") % (stream_name,)) return subscription @authenticated_json_view @has_request_variables def json_subscription_property(request, user_profile, subscription_data=REQ( validator=check_list( check_dict([("stream", check_string), ("property", check_string), ("value", check_variable_type( [check_string, check_bool]))])))): # type: (HttpRequest, UserProfile, List[Dict[str, Any]]) -> HttpResponse """ This is the entry point to changing subscription properties. This is a bulk endpoint: requestors always provide a subscription_data list containing dictionaries for each stream of interest. Requests are of the form: [{"stream": "devel", "property": "in_home_view", "value": False}, {"stream": "devel", "property": "color", "value": "#c2c2c2"}] """ if request.method != "POST": return json_error(_("Invalid verb")) property_converters = {"color": check_string, "in_home_view": check_bool, "desktop_notifications": check_bool, "audible_notifications": check_bool, "pin_to_top": check_bool} response_data = [] for change in subscription_data: stream_name = change["stream"] property = change["property"] value = change["value"] if property not in property_converters: return json_error(_("Unknown subscription property: %s") % (property,)) sub = get_subscription_or_die(stream_name, user_profile)[0] property_conversion = property_converters[property](property, value) if property_conversion: return json_error(property_conversion) do_change_subscription_property(user_profile, sub, stream_name, property, value) response_data.append({'stream': stream_name, 'property': property, 'value': value}) return json_success({"subscription_data": response_data})